×
![]()
Chemical Molecules
Molecule Details
| Molecule ID | MOL44 | ||
| Compound Name | Juniper camphor | ||
| ⤓Download 2D Structure File | ⤓Download 3D Structure File | View Structure Image |
Structure Image
|
Primary Details
| Compound Name | Juniper camphor |
| Synonym Name | 7(11)-Selinen-4.alpha.-ol, (+)-Selin-7(11)-en-4.alpha.-ol |
| CAS ID | 53840-55-4 |
| IUPAC Name | 1,4a-dimethyl-7-propan-2-ylidene-3,4,5,6,8,8a-hexahydro-2H-naphthalen-1-ol |
| Molecular Formula | |
| Chemical Safety | Nil |
| External Database ID |
521214 |
| Inchi | InChI=1S/C15H26O/c1-11(2)12-6-9-14(3)7-5-8-15(4,16)13(14)10-12/h13,16H,5-10H2,1-4H3 |
| INCHI Key | STRABSCAWZINIF-UHFFFAOYSA-N |
| Canonical SMILES | CC(=C1CCC2(CCCC(C2C1)(C)O)C)C |
| Molecule Type | Natural |
| Group | Phytochemicals |
| Sub-Group 1 | Terpenoids (Isoprenoids) |
| Sub-Group 2 | sesquiterpenoid |
| Sub-Group 3 | - |
| Sub-Group 4 | - |
| Sub-Group 5 | - |
| Description |
Juniper Camphor is an essential oil component, shown to have antifungal activity |
Chemical & Physical Properties
| Molecular Weight | 222.37 g/mol |
| LogP (Octanol-Water) | 4.319 |
| Hydrogen Donor Count | 1 |
| Bond Acceptor Count | 1 |
| Rotable Bond Count | 0 |
| Topological Surface Area | 20.2 Ų |
| Heavy Atom Count | 16 |
| Melting Point | Nil |
| Boiling Point | Nil |
| Water Solubility | Nil |
| Henry's Law Constant | Nil |
| pKa Dissociation Constant | Nil |
| Vapour Pressure | |
| Molecule Density | |
| Molecule Stability | |
| Kovats retention Index | Semi-standard non-polar: 1696 |
| Physical Description |
|
Spectra Information
Biological Activities
| Activity Name | |
| Molecule Target | |
| Comment |
|
| References |
|