×
![]()
Chemical Molecules
Molecule Details
| Molecule ID | MOL30 | ||
| Compound Name | gamma-Dodecalactone | ||
| ⤓Download 2D Structure File | ⤓Download 3D Structure File | View Structure Image |
Structure Image
|
Primary Details
| Compound Name | gamma-Dodecalactone |
| Synonym Name | 4-Dodecanolide, 5-octyloxolan-2-one |
| CAS ID | 5/7/2305 |
| IUPAC Name | 5-octyloxolan-2-one |
| Molecular Formula | C12H22O2 |
| Chemical Safety | Nil |
| External Database ID |
16821 |
| Inchi | InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-11-9-10-12(13)14-11/h11H,2-10H2,1H3 |
| INCHI Key | WGPCZPLRVAWXPW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCC1CCC(=O)O1 |
| Molecule Type | - |
| Group | - |
| Sub-Group 1 | - |
| Sub-Group 2 | - |
| Sub-Group 3 | - |
| Sub-Group 4 | - |
| Sub-Group 5 | - |
| Description |
Gamma-Decalactone, characterized by the chemical formula C10H18O2, is an aroma compound and lactone. Its robust peach flavor is naturally found in various fruits and fermentations. This compound plays a crucial role in crafting flavor profiles for beverages, food items, personal care products, pharmaceuticals, and household goods, especially those featuring peach, apricot, and strawberry notes |
Chemical & Physical Properties
| Molecular Weight | 198.30 g/mol |
| LogP (Octanol-Water) | 4.04 |
| Hydrogen Donor Count | 0 |
| Bond Acceptor Count | 2 |
| Rotable Bond Count | 7 |
| Topological Surface Area | 26.3 Ų |
| Heavy Atom Count | 14 |
| Melting Point | Nil |
| Boiling Point | Nil |
| Water Solubility | 1 ml in 1 ml 95% alcohol |
| Henry's Law Constant | Nil |
| pKa Dissociation Constant | Nil |
| Vapour Pressure | Nil |
| Molecule Density | 0.933-0.938 |
| Molecule Stability | Nil |
| Kovats retention Index | Standard polar: 2372, 2415, 2372, 2381, 2366, 2366, 2380, 2367 |
| Physical Description |
|
Spectra Information
Biological Activities
| Activity Name | |
| Molecule Target | |
| Comment |
|
| References |
|